C12H23N3Pt — CID 160672100
(1-tert-butyl-3-methylimidazol-2-ylidene)platinum;cyclobutanamine (PubChem CID 160672100) has the molecular formula C12H23N3Pt and a molecular weight of 404.42 g/mol. Its IUPAC name is (1-tert-butyl-3-methylimidazol-2-ylidene)platinum;cyclobutanamine.
| Compound Name | (1-tert-butyl-3-methylimidazol-2-ylidene)platinum;cyclobutanamine |
|---|---|
| PubChem CID | 160672100 |
| Molecular Formula | C12H23N3Pt |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (1-tert-butyl-3-methylimidazol-2-ylidene)platinum;cyclobutanamine |
| SMILES | Cn1ccn(C(C)(C)C)c1=[Pt].NC1CCC1 |
| InChI | InChI=1S/C8H14N2.C4H9N.Pt/c1-8(2,3)10-6-5-9(4)7-10;5-4-2-1-3-4;/h5-6H,1-4H3;4H,1-3,5H2; |
| InChIKey | RNBBLMUHYZQBTH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |