C13H21I2N3Pt — CID 87351737
N,N-diiodocycloheptanamine;(1-ethenyl-3-methylimidazol-2-ylidene)platinum (PubChem CID 87351737) has the molecular formula C13H21I2N3Pt and a molecular weight of 668.22 g/mol. Its IUPAC name is N,N-diiodocycloheptanamine;(1-ethenyl-3-methylimidazol-2-ylidene)platinum.
| Compound Name | N,N-diiodocycloheptanamine;(1-ethenyl-3-methylimidazol-2-ylidene)platinum |
|---|---|
| PubChem CID | 87351737 |
| Molecular Formula | C13H21I2N3Pt |
| Molecular Weight | 668.22 g/mol |
| Exact Mass | 667.95 |
| IUPAC Name | N,N-diiodocycloheptanamine;(1-ethenyl-3-methylimidazol-2-ylidene)platinum |
| SMILES | C=Cn1ccn(C)c1=[Pt].IN(I)C1CCCCCC1 |
| InChI | InChI=1S/C7H13I2N.C6H8N2.Pt/c8-10(9)7-5-3-1-2-4-6-7;1-3-8-5-4-7(2)6-8;/h7H,1-6H2;3-5H,1H2,2H3; |
| InChIKey | RTEOUTSOHZPPEP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.22 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|