C23H27Br2N3Pt — CID 87351879
N,N-dibromocyclohexanamine;(1,3-dimethyl-4,5-diphenylimidazol-2-ylidene)platinum (PubChem CID 87351879) has the molecular formula C23H27Br2N3Pt and a molecular weight of 700.38 g/mol. Its IUPAC name is N,N-dibromocyclohexanamine;(1,3-dimethyl-4,5-diphenylimidazol-2-ylidene)platinum.
| Compound Name | N,N-dibromocyclohexanamine;(1,3-dimethyl-4,5-diphenylimidazol-2-ylidene)platinum |
|---|---|
| PubChem CID | 87351879 |
| Molecular Formula | C23H27Br2N3Pt |
| Molecular Weight | 700.38 g/mol |
| Exact Mass | 698.02 |
| IUPAC Name | N,N-dibromocyclohexanamine;(1,3-dimethyl-4,5-diphenylimidazol-2-ylidene)platinum |
| SMILES | BrN(Br)C1CCCCC1.Cn1c(-c2ccccc2)c(-c2ccccc2)n(C)c1=[Pt] |
| InChI | InChI=1S/C17H16N2.C6H11Br2N.Pt/c1-18-13-19(2)17(15-11-7-4-8-12-15)16(18)14-9-5-3-6-10-14;7-9(8)6-4-2-1-3-5-6;/h3-12H,1-2H3;6H,1-5H2; |
| InChIKey | LVPARQGOJYMBBV-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.38 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|