C15H19I2N3Pt — CID 87351935
N,N-diiodocyclobutanamine;(1,3-dimethyl-4-phenylimidazol-2-ylidene)platinum (PubChem CID 87351935) has the molecular formula C15H19I2N3Pt and a molecular weight of 690.22 g/mol. Its IUPAC name is N,N-diiodocyclobutanamine;(1,3-dimethyl-4-phenylimidazol-2-ylidene)platinum.
| Compound Name | N,N-diiodocyclobutanamine;(1,3-dimethyl-4-phenylimidazol-2-ylidene)platinum |
|---|---|
| PubChem CID | 87351935 |
| Molecular Formula | C15H19I2N3Pt |
| Molecular Weight | 690.22 g/mol |
| Exact Mass | 689.93 |
| IUPAC Name | N,N-diiodocyclobutanamine;(1,3-dimethyl-4-phenylimidazol-2-ylidene)platinum |
| SMILES | Cn1cc(-c2ccccc2)n(C)c1=[Pt].IN(I)C1CCC1 |
| InChI | InChI=1S/C11H12N2.C4H7I2N.Pt/c1-12-8-11(13(2)9-12)10-6-4-3-5-7-10;5-7(6)4-2-1-3-4;/h3-8H,1-2H3;4H,1-3H2; |
| InChIKey | XEKHBMWWZCSAJY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.22 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|