C18H23N3O2S2 — CID 34886516
1-[[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]methyl]-3-methyl-4-phenylimidazole-2-thione (PubChem CID 34886516) has the molecular formula C18H23N3O2S2 and a molecular weight of 377.54 g/mol. Its IUPAC name is 1-[[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]methyl]-3-methyl-4-phenylimidazole-2-thione.
| Compound Name | 1-[[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]methyl]-3-methyl-4-phenylimidazole-2-thione |
|---|---|
| PubChem CID | 34886516 |
| Molecular Formula | C18H23N3O2S2 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-[[cyclopropyl-[(3R)-1,1-dioxothiolan-3-yl]amino]methyl]-3-methyl-4-phenylimidazole-2-thione |
| SMILES | Cn1c(-c2ccccc2)cn(CN(C2CC2)[C@@H]2CCS(=O)(=O)C2)c1=S |
| InChI | InChI=1S/C18H23N3O2S2/c1-19-17(14-5-3-2-4-6-14)11-20(18(19)24)13-21(15-7-8-15)16-9-10-25(22,23)12-16/h2-6,11,15-16H,7-10,12-13H2,1H3/t16-/m1/s1 |
| InChIKey | KYMHQRFMYIJEGY-MRXNPFEDSA-N |
| XLogP | 2.83 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|