C19H31I2N3Pt — CID 87352119
(1,3-dicyclohexylimidazol-2-ylidene)platinum;N,N-diiodocyclobutanamine (PubChem CID 87352119) has the molecular formula C19H31I2N3Pt and a molecular weight of 750.36 g/mol. Its IUPAC name is (1,3-dicyclohexylimidazol-2-ylidene)platinum;N,N-diiodocyclobutanamine.
| Compound Name | (1,3-dicyclohexylimidazol-2-ylidene)platinum;N,N-diiodocyclobutanamine |
|---|---|
| PubChem CID | 87352119 |
| Molecular Formula | C19H31I2N3Pt |
| Molecular Weight | 750.36 g/mol |
| Exact Mass | 750.03 |
| IUPAC Name | (1,3-dicyclohexylimidazol-2-ylidene)platinum;N,N-diiodocyclobutanamine |
| SMILES | IN(I)C1CCC1.[Pt]=c1n(C2CCCCC2)ccn1C1CCCCC1 |
| InChI | InChI=1S/C15H24N2.C4H7I2N.Pt/c1-3-7-14(8-4-1)16-11-12-17(13-16)15-9-5-2-6-10-15;5-7(6)4-2-1-3-4;/h11-12,14-15H,1-10H2;4H,1-3H2; |
| InChIKey | DYCIONDBRNIIIR-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.36 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|