C12H19Br2N3Pt — CID 87351736
N,N-dibromobicyclo[2.2.1]heptan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum (PubChem CID 87351736) has the molecular formula C12H19Br2N3Pt and a molecular weight of 560.19 g/mol. Its IUPAC name is N,N-dibromobicyclo[2.2.1]heptan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum.
| Compound Name | N,N-dibromobicyclo[2.2.1]heptan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum |
|---|---|
| PubChem CID | 87351736 |
| Molecular Formula | C12H19Br2N3Pt |
| Molecular Weight | 560.19 g/mol |
| Exact Mass | 557.96 |
| IUPAC Name | N,N-dibromobicyclo[2.2.1]heptan-1-amine;(1,3-dimethylimidazol-2-ylidene)platinum |
| SMILES | BrN(Br)C12CCC(CC1)C2.Cn1ccn(C)c1=[Pt] |
| InChI | InChI=1S/C7H11Br2N.C5H8N2.Pt/c8-10(9)7-3-1-6(5-7)2-4-7;1-6-3-4-7(2)5-6;/h6H,1-5H2;3-4H,1-2H3; |
| InChIKey | UDOAGMGJDVQSAB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|