About 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol
1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol (PubChem CID 157264679) has the molecular formula C26H25BrO4
and a molecular weight of 481.39 g/mol. Its IUPAC name is 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol.
Molecular Properties
| Compound Name | 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol |
| PubChem CID | 157264679 |
| Molecular Formula | C26H25BrO4 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol |
| SMILES | COc1cccc(Br)c1.COc1cccc(Oc2ccccc2)c1.Oc1ccccc1 |
| InChI | InChI=1S/C13H12O2.C7H7BrO.C6H6O/c1-14-12-8-5-9-13(10-12)15-11-6-3-2-4-7-11;1-9-7-4-2-3-6(8)5-7;7-6-4-2-1-3-5-6/h2-10H,1H3;2-5H,1H3;1-5,7H |
| InChIKey | AXVZJVFYHKJTJX-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol?
The IUPAC name of 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol (CID 157264679) is 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol.
What is the SMILES notation for 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol?
The canonical SMILES for 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol is COc1cccc(Br)c1.COc1cccc(Oc2ccccc2)c1.Oc1ccccc1.
What is the InChIKey of 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol?
The InChIKey is AXVZJVFYHKJTJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2.C7H7BrO.C6H6O/c1-14-12-8-5-9-13(10-12)15-11-6-3-2-4-7-11;1-9-7-4-2-3-6(8)5-7;7-6-4-2-1-3-5-6/h2-10H,1H3;2-5H,1H3;1-5,7H.
What are the key properties of 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol?
1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol has a molecular weight of 481.39 g/mol, XLogP of 7.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-methoxybenzene;1-methoxy-3-phenoxybenzene;phenol is sourced from PubChem (CID 157264679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).