C31H34INO12 — CID 157265289
2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate;ethyl 4-iodobenzoate (PubChem CID 157265289) has the molecular formula C31H34INO12 and a molecular weight of 739.51 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate;ethyl 4-iodobenzoate.
| Compound Name | 2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate;ethyl 4-iodobenzoate |
|---|---|
| PubChem CID | 157265289 |
| Molecular Formula | C31H34INO12 |
| Molecular Weight | 739.51 g/mol |
| Exact Mass | 739.11 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxane-4,6-dione;ethyl 4-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-ylidene)methylamino]benzoate;ethyl 4-iodobenzoate |
| SMILES | CC1(C)OC(=O)CC(=O)O1.CCOC(=O)c1ccc(I)cc1.CCOC(=O)c1ccc(NC=C2C(=O)OC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C16H17NO6.C9H9IO2.C6H8O4/c1-4-21-13(18)10-5-7-11(8-6-10)17-9-12-14(19)22-16(2,3)23-15(12)20;1-2-12-9(11)7-3-5-8(10)6-4-7;1-6(2)9-4(7)3-5(8)10-6/h5-9,17H,4H2,1-3H3;3-6H,2H2,1H3;3H2,1-2H3 |
| InChIKey | AXXRAEMLKKNFDW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|