C19H25F5O5 — CID 157265352
2-[5,5-difluoro-4-(fluoromethyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxyethyl 2,2-difluoropropanoate (PubChem CID 157265352) has the molecular formula C19H25F5O5 and a molecular weight of 428.39 g/mol. Its IUPAC name is 2-[5,5-difluoro-4-(fluoromethyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxyethyl 2,2-difluoropropanoate.
| Compound Name | 2-[5,5-difluoro-4-(fluoromethyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxyethyl 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 157265352 |
| Molecular Formula | C19H25F5O5 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-[5,5-difluoro-4-(fluoromethyl)spiro[1,3-dioxane-2,4'-adamantane]-1'-yl]oxyethyl 2,2-difluoropropanoate |
| SMILES | CC(F)(F)C(=O)OCCOC12CC3CC(C1)C1(OCC(F)(F)C(CF)O1)C(C3)C2 |
| InChI | InChI=1S/C19H25F5O5/c1-16(21,22)15(25)26-2-3-27-17-6-11-4-12(7-17)19(13(5-11)8-17)28-10-18(23,24)14(9-20)29-19/h11-14H,2-10H2,1H3 |
| InChIKey | PVHSRPKMHADUDJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|