C34H39N7O10 — CID 157266473
2-phenoxyethyl 4-[3-[4-[bis(cyanomethyl)amino]-4-oxobutyl]-2,4,6-trioxo-5-[2-(2-phenoxyethoxycarbonylamino)ethyl]-1,3,5-triazinan-1-yl]butanoate (PubChem CID 157266473) has the molecular formula C34H39N7O10 and a molecular weight of 705.73 g/mol. Its IUPAC name is 2-phenoxyethyl 4-[3-[4-[bis(cyanomethyl)amino]-4-oxobutyl]-2,4,6-trioxo-5-[2-(2-phenoxyethoxycarbonylamino)ethyl]-1,3,5-triazinan-1-yl]butanoate.
| Compound Name | 2-phenoxyethyl 4-[3-[4-[bis(cyanomethyl)amino]-4-oxobutyl]-2,4,6-trioxo-5-[2-(2-phenoxyethoxycarbonylamino)ethyl]-1,3,5-triazinan-1-yl]butanoate |
|---|---|
| PubChem CID | 157266473 |
| Molecular Formula | C34H39N7O10 |
| Molecular Weight | 705.73 g/mol |
| Exact Mass | 705.28 |
| IUPAC Name | 2-phenoxyethyl 4-[3-[4-[bis(cyanomethyl)amino]-4-oxobutyl]-2,4,6-trioxo-5-[2-(2-phenoxyethoxycarbonylamino)ethyl]-1,3,5-triazinan-1-yl]butanoate |
| SMILES | N#CCN(CC#N)C(=O)CCCn1c(=O)n(CCCC(=O)OCCOc2ccccc2)c(=O)n(CCNC(=O)OCCOc2ccccc2)c1=O |
| InChI | InChI=1S/C34H39N7O10/c35-15-20-38(21-16-36)29(42)13-7-18-39-32(45)40(19-8-14-30(43)50-25-23-48-27-9-3-1-4-10-27)34(47)41(33(39)46)22-17-37-31(44)51-26-24-49-28-11-5-2-6-12-28/h1-6,9-12H,7-8,13-14,17-26H2,(H,37,44) |
| InChIKey | NBNLQBDMBFAQTR-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 216.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.73 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|