C24H25FN4O — CID 157268874
2-(2-amino-5-fluorophenyl)-1-(8-cyclopropyl-7-piperazin-1-ylquinolin-3-yl)ethanone (PubChem CID 157268874) has the molecular formula C24H25FN4O and a molecular weight of 404.49 g/mol. Its IUPAC name is 2-(2-amino-5-fluorophenyl)-1-(8-cyclopropyl-7-piperazin-1-ylquinolin-3-yl)ethanone.
| Compound Name | 2-(2-amino-5-fluorophenyl)-1-(8-cyclopropyl-7-piperazin-1-ylquinolin-3-yl)ethanone |
|---|---|
| PubChem CID | 157268874 |
| Molecular Formula | C24H25FN4O |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 2-(2-amino-5-fluorophenyl)-1-(8-cyclopropyl-7-piperazin-1-ylquinolin-3-yl)ethanone |
| SMILES | Nc1ccc(F)cc1CC(=O)c1cnc2c(C3CC3)c(N3CCNCC3)ccc2c1 |
| InChI | InChI=1S/C24H25FN4O/c25-19-4-5-20(26)17(12-19)13-22(30)18-11-16-3-6-21(29-9-7-27-8-10-29)23(15-1-2-15)24(16)28-14-18/h3-6,11-12,14-15,27H,1-2,7-10,13,26H2 |
| InChIKey | IMUHRMOIAUPRFN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|