C24H24FN4O6PS — CID 157269856
2-[5-amino-6-[2-[4-(diethoxyphosphorylmethylsulfonyl)phenyl]acetyl]pyrazin-2-yl]-4-fluorobenzonitrile (PubChem CID 157269856) has the molecular formula C24H24FN4O6PS and a molecular weight of 546.52 g/mol. Its IUPAC name is 2-[5-amino-6-[2-[4-(diethoxyphosphorylmethylsulfonyl)phenyl]acetyl]pyrazin-2-yl]-4-fluorobenzonitrile.
| Compound Name | 2-[5-amino-6-[2-[4-(diethoxyphosphorylmethylsulfonyl)phenyl]acetyl]pyrazin-2-yl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 157269856 |
| Molecular Formula | C24H24FN4O6PS |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 2-[5-amino-6-[2-[4-(diethoxyphosphorylmethylsulfonyl)phenyl]acetyl]pyrazin-2-yl]-4-fluorobenzonitrile |
| SMILES | CCOP(=O)(CS(=O)(=O)c1ccc(CC(=O)c2nc(-c3cc(F)ccc3C#N)cnc2N)cc1)OCC |
| InChI | InChI=1S/C24H24FN4O6PS/c1-3-34-36(31,35-4-2)15-37(32,33)19-9-5-16(6-10-19)11-22(30)23-24(27)28-14-21(29-23)20-12-18(25)8-7-17(20)13-26/h5-10,12,14H,3-4,11,15H2,1-2H3,(H2,27,28) |
| InChIKey | XPBSMZWOFGCLTO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 162.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|