About 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene
2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene (PubChem CID 157273854) has the molecular formula C36H33Br
and a molecular weight of 545.56 g/mol. Its IUPAC name is 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene.
Molecular Properties
| Compound Name | 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene |
| PubChem CID | 157273854 |
| Molecular Formula | C36H33Br |
| Molecular Weight | 545.56 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene |
| SMILES | Brc1ccc2ccccc2c1.C#CC1=CCCCC1.C(#Cc1ccc2ccccc2c1)C1=CCCCC1 |
| InChI | InChI=1S/C18H16.C10H7Br.C8H10/c1-2-6-15(7-3-1)10-11-16-12-13-17-8-4-5-9-18(17)14-16;11-10-6-5-8-3-1-2-4-9(8)7-10;1-2-8-6-4-3-5-7-8/h4-6,8-9,12-14H,1-3,7H2;1-7H;1,6H,3-5,7H2 |
| InChIKey | AYVWXYVYGKLJOE-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.56 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene?
The IUPAC name of 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene (CID 157273854) is 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene.
What is the SMILES notation for 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene?
The canonical SMILES for 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene is Brc1ccc2ccccc2c1.C#CC1=CCCCC1.C(#Cc1ccc2ccccc2c1)C1=CCCCC1.
What is the InChIKey of 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene?
The InChIKey is AYVWXYVYGKLJOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16.C10H7Br.C8H10/c1-2-6-15(7-3-1)10-11-16-12-13-17-8-4-5-9-18(17)14-16;11-10-6-5-8-3-1-2-4-9(8)7-10;1-2-8-6-4-3-5-7-8/h4-6,8-9,12-14H,1-3,7H2;1-7H;1,6H,3-5,7H2.
What are the key properties of 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene?
2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene has a molecular weight of 545.56 g/mol, XLogP of 10.41, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromonaphthalene;2-[2-(cyclohexen-1-yl)ethynyl]naphthalene;1-ethynylcyclohexene is sourced from PubChem (CID 157273854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).