C36H51ClN2O7 — CID 157284515
tert-butyl N-[3-(3,7,8-trimethoxy-1,4-dihydronaphthalen-2-yl)propyl]carbamate;6,7-dimethoxy-2,3,4,4a,5,10-hexahydrobenzo[g]quinoline;hydrochloride (PubChem CID 157284515) has the molecular formula C36H51ClN2O7 and a molecular weight of 659.26 g/mol. Its IUPAC name is tert-butyl N-[3-(3,7,8-trimethoxy-1,4-dihydronaphthalen-2-yl)propyl]carbamate;6,7-dimethoxy-2,3,4,4a,5,10-hexahydrobenzo[g]quinoline;hydrochloride.
| Compound Name | tert-butyl N-[3-(3,7,8-trimethoxy-1,4-dihydronaphthalen-2-yl)propyl]carbamate;6,7-dimethoxy-2,3,4,4a,5,10-hexahydrobenzo[g]quinoline;hydrochloride |
|---|---|
| PubChem CID | 157284515 |
| Molecular Formula | C36H51ClN2O7 |
| Molecular Weight | 659.26 g/mol |
| Exact Mass | 658.34 |
| IUPAC Name | tert-butyl N-[3-(3,7,8-trimethoxy-1,4-dihydronaphthalen-2-yl)propyl]carbamate;6,7-dimethoxy-2,3,4,4a,5,10-hexahydrobenzo[g]quinoline;hydrochloride |
| SMILES | COC1=C(CCCNC(=O)OC(C)(C)C)Cc2c(ccc(OC)c2OC)C1.COc1ccc2c(c1OC)CC1CCCN=C1C2.Cl |
| InChI | InChI=1S/C21H31NO5.C15H19NO2.ClH/c1-21(2,3)27-20(23)22-11-7-8-15-12-16-14(13-18(15)25-5)9-10-17(24-4)19(16)26-6;1-17-14-6-5-10-9-13-11(4-3-7-16-13)8-12(10)15(14)18-2;/h9-10H,7-8,11-13H2,1-6H3,(H,22,23);5-6,11H,3-4,7-9H2,1-2H3;1H |
| InChIKey | FOXRMZAPOWDIJC-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.26 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|