C25H22F7NO8 — CID 157286058
4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-enoic acid;3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzoic acid (PubChem CID 157286058) has the molecular formula C25H22F7NO8 and a molecular weight of 597.44 g/mol. Its IUPAC name is 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-enoic acid;3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzoic acid.
| Compound Name | 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-enoic acid;3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzoic acid |
|---|---|
| PubChem CID | 157286058 |
| Molecular Formula | C25H22F7NO8 |
| Molecular Weight | 597.44 g/mol |
| Exact Mass | 597.12 |
| IUPAC Name | 4,5,5,5-tetrafluoro-4-(trifluoromethyl)pent-2-enoic acid;3-[3-(3,4,5-trimethoxyphenyl)prop-2-enoylamino]benzoic acid |
| SMILES | COc1cc(C=CC(=O)Nc2cccc(C(=O)O)c2)cc(OC)c1OC.O=C(O)C=CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H19NO6.C6H3F7O2/c1-24-15-9-12(10-16(25-2)18(15)26-3)7-8-17(21)20-14-6-4-5-13(11-14)19(22)23;7-4(5(8,9)10,6(11,12)13)2-1-3(14)15/h4-11H,1-3H3,(H,20,21)(H,22,23);1-2H,(H,14,15) |
| InChIKey | BAGATSOFLGPOAF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|