C24H21N2S+ — CID 157291479
5,14-dimethyl-13-[2-methyl-4-(trideuteriomethyl)phenyl]-17-thia-2-aza-14-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene (PubChem CID 157291479) has the molecular formula C24H21N2S+ and a molecular weight of 372.53 g/mol. Its IUPAC name is 5,14-dimethyl-13-[2-methyl-4-(trideuteriomethyl)phenyl]-17-thia-2-aza-14-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene.
| Compound Name | 5,14-dimethyl-13-[2-methyl-4-(trideuteriomethyl)phenyl]-17-thia-2-aza-14-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene |
|---|---|
| PubChem CID | 157291479 |
| Molecular Formula | C24H21N2S+ |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 5,14-dimethyl-13-[2-methyl-4-(trideuteriomethyl)phenyl]-17-thia-2-aza-14-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene |
| SMILES | [2H]C([2H])([2H])c1ccc(-c2cc3c(c[n+]2C)sc2nc4cc(C)ccc4cc23)c(C)c1 |
| InChI | InChI=1S/C24H21N2S/c1-14-6-8-18(16(3)9-14)22-12-19-20-11-17-7-5-15(2)10-21(17)25-24(20)27-23(19)13-26(22)4/h5-13H,1-4H3/q+1/i1D3 |
| InChIKey | GVYPUMHAIZHDMP-FIBGUPNXSA-N |
| XLogP | 6.02 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|