C32H47NO9S2 — CID 157292668
3-[5-(2-oxopropyl)thiophen-2-yl]sulfonyliminopropyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate (PubChem CID 157292668) has the molecular formula C32H47NO9S2 and a molecular weight of 653.86 g/mol. Its IUPAC name is 3-[5-(2-oxopropyl)thiophen-2-yl]sulfonyliminopropyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate.
| Compound Name | 3-[5-(2-oxopropyl)thiophen-2-yl]sulfonyliminopropyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 157292668 |
| Molecular Formula | C32H47NO9S2 |
| Molecular Weight | 653.86 g/mol |
| Exact Mass | 653.27 |
| IUPAC Name | 3-[5-(2-oxopropyl)thiophen-2-yl]sulfonyliminopropyl (Z)-7-[(1R,2R,3R,5S)-5-acetyloxy-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)OCCC=NS(=O)(=O)c2ccc(CC(C)=O)s2)[C@@H](OC(C)=O)C[C@H]1O |
| InChI | InChI=1S/C32H47NO9S2/c1-4-5-8-12-25(36)15-17-27-28(30(22-29(27)37)42-24(3)35)13-9-6-7-10-14-31(38)41-20-11-19-33-44(39,40)32-18-16-26(43-32)21-23(2)34/h6,9,15-19,25,27-30,36-37H,4-5,7-8,10-14,20-22H2,1-3H3/b9-6-,17-15+,33-19?/t25-,27+,28+,29+,30-/m0/s1 |
| InChIKey | DYWDTFPKELRFTR-OOJIBKGWSA-N |
| XLogP | 5.12 |
| TPSA | 156.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.86 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|