C23H27F3N4O2 — CID 157293005
2-[5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-2-pyridinyl]hexanamide (PubChem CID 157293005) has the molecular formula C23H27F3N4O2 and a molecular weight of 448.49 g/mol. Its IUPAC name is 2-[5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-2-pyridinyl]hexanamide.
| Compound Name | 2-[5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-2-pyridinyl]hexanamide |
|---|---|
| PubChem CID | 157293005 |
| Molecular Formula | C23H27F3N4O2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-[5-[4-[2-(trifluoromethyl)benzoyl]piperazin-1-yl]-2-pyridinyl]hexanamide |
| SMILES | CCCCC(C(N)=O)c1ccc(N2CCN(C(=O)c3ccccc3C(F)(F)F)CC2)cn1 |
| InChI | InChI=1S/C23H27F3N4O2/c1-2-3-6-18(21(27)31)20-10-9-16(15-28-20)29-11-13-30(14-12-29)22(32)17-7-4-5-8-19(17)23(24,25)26/h4-5,7-10,15,18H,2-3,6,11-14H2,1H3,(H2,27,31) |
| InChIKey | BBAFREJQEZIQTC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |