C21H21F3N2OS — CID 157293755
2-[[4-pentoxy-3-(trifluoromethyl)phenyl]methyl]-4-pyridin-4-yl-1,3-thiazole (PubChem CID 157293755) has the molecular formula C21H21F3N2OS and a molecular weight of 406.47 g/mol. Its IUPAC name is 2-[[4-pentoxy-3-(trifluoromethyl)phenyl]methyl]-4-pyridin-4-yl-1,3-thiazole.
| Compound Name | 2-[[4-pentoxy-3-(trifluoromethyl)phenyl]methyl]-4-pyridin-4-yl-1,3-thiazole |
|---|---|
| PubChem CID | 157293755 |
| Molecular Formula | C21H21F3N2OS |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 2-[[4-pentoxy-3-(trifluoromethyl)phenyl]methyl]-4-pyridin-4-yl-1,3-thiazole |
| SMILES | CCCCCOc1ccc(Cc2nc(-c3ccncc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H21F3N2OS/c1-2-3-4-11-27-19-6-5-15(12-17(19)21(22,23)24)13-20-26-18(14-28-20)16-7-9-25-10-8-16/h5-10,12,14H,2-4,11,13H2,1H3 |
| InChIKey | BBCGECUAUPTJAJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|