C19H16ClN3O2 — CID 157294267
4-(6-chloro-3-pyridinyl)-2-[[3-(1,3-dioxolan-2-yl)phenyl]methyl]pyrimidine (PubChem CID 157294267) has the molecular formula C19H16ClN3O2 and a molecular weight of 353.81 g/mol. Its IUPAC name is 4-(6-chloro-3-pyridinyl)-2-[[3-(1,3-dioxolan-2-yl)phenyl]methyl]pyrimidine.
| Compound Name | 4-(6-chloro-3-pyridinyl)-2-[[3-(1,3-dioxolan-2-yl)phenyl]methyl]pyrimidine |
|---|---|
| PubChem CID | 157294267 |
| Molecular Formula | C19H16ClN3O2 |
| Molecular Weight | 353.81 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 4-(6-chloro-3-pyridinyl)-2-[[3-(1,3-dioxolan-2-yl)phenyl]methyl]pyrimidine |
| SMILES | Clc1ccc(-c2ccnc(Cc3cccc(C4OCCO4)c3)n2)cn1 |
| InChI | InChI=1S/C19H16ClN3O2/c20-17-5-4-15(12-22-17)16-6-7-21-18(23-16)11-13-2-1-3-14(10-13)19-24-8-9-25-19/h1-7,10,12,19H,8-9,11H2 |
| InChIKey | BBDUMUVNKJQKKN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.81 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|