C33H34 — CID 157296228
9-propan-2-yl-9,10-dihydroanthracene;9-propan-2-yl-9H-fluorene (PubChem CID 157296228) has the molecular formula C33H34 and a molecular weight of 430.64 g/mol. Its IUPAC name is 9-propan-2-yl-9,10-dihydroanthracene;9-propan-2-yl-9H-fluorene.
| Compound Name | 9-propan-2-yl-9,10-dihydroanthracene;9-propan-2-yl-9H-fluorene |
|---|---|
| PubChem CID | 157296228 |
| Molecular Formula | C33H34 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 9-propan-2-yl-9,10-dihydroanthracene;9-propan-2-yl-9H-fluorene |
| SMILES | CC(C)C1c2ccccc2-c2ccccc21.CC(C)C1c2ccccc2Cc2ccccc21 |
| InChI | InChI=1S/C17H18.C16H16/c1-12(2)17-15-9-5-3-7-13(15)11-14-8-4-6-10-16(14)17;1-11(2)16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16/h3-10,12,17H,11H2,1-2H3;3-11,16H,1-2H3 |
| InChIKey | BBJKXTGJTRICJZ-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |