C28H48Si2 — CID 157298848
(3,5-dimethylphenyl)-triethylsilane;triethyl-[(3-methylphenyl)methyl]silane (PubChem CID 157298848) has the molecular formula C28H48Si2 and a molecular weight of 440.86 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-triethylsilane;triethyl-[(3-methylphenyl)methyl]silane.
| Compound Name | (3,5-dimethylphenyl)-triethylsilane;triethyl-[(3-methylphenyl)methyl]silane |
|---|---|
| PubChem CID | 157298848 |
| Molecular Formula | C28H48Si2 |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | (3,5-dimethylphenyl)-triethylsilane;triethyl-[(3-methylphenyl)methyl]silane |
| SMILES | CC[Si](CC)(CC)Cc1cccc(C)c1.CC[Si](CC)(CC)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/2C14H24Si/c1-6-15(7-2,8-3)14-10-12(4)9-13(5)11-14;1-5-15(6-2,7-3)12-14-10-8-9-13(4)11-14/h9-11H,6-8H2,1-5H3;8-11H,5-7,12H2,1-4H3 |
| InChIKey | BBQSCQTWWQVVJZ-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|