C30H36N6O8 — CID 157300525
tert-butyl 3-(4-amino-2-cyanophenoxy)azetidine-1-carboxylate;tert-butyl 3-(2-cyano-4-nitrophenoxy)azetidine-1-carboxylate (PubChem CID 157300525) has the molecular formula C30H36N6O8 and a molecular weight of 608.65 g/mol. Its IUPAC name is tert-butyl 3-(4-amino-2-cyanophenoxy)azetidine-1-carboxylate;tert-butyl 3-(2-cyano-4-nitrophenoxy)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-amino-2-cyanophenoxy)azetidine-1-carboxylate;tert-butyl 3-(2-cyano-4-nitrophenoxy)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 157300525 |
| Molecular Formula | C30H36N6O8 |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | tert-butyl 3-(4-amino-2-cyanophenoxy)azetidine-1-carboxylate;tert-butyl 3-(2-cyano-4-nitrophenoxy)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2ccc(N)cc2C#N)C1.CC(C)(C)OC(=O)N1CC(Oc2ccc([N+](=O)[O-])cc2C#N)C1 |
| InChI | InChI=1S/C15H17N3O5.C15H19N3O3/c1-15(2,3)23-14(19)17-8-12(9-17)22-13-5-4-11(18(20)21)6-10(13)7-16;1-15(2,3)21-14(19)18-8-12(9-18)20-13-5-4-11(17)6-10(13)7-16/h4-6,12H,8-9H2,1-3H3;4-6,12H,8-9,17H2,1-3H3 |
| InChIKey | BBVQXKHZGCARJA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 194.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|