C26H31F3N4 — CID 157301618
N,N-dimethyl-3-[5-methyl-3-phenyl-7-[[3-(trifluoromethyl)phenyl]methylidene]-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridin-2-yl]propan-1-amine (PubChem CID 157301618) has the molecular formula C26H31F3N4 and a molecular weight of 456.56 g/mol. Its IUPAC name is N,N-dimethyl-3-[5-methyl-3-phenyl-7-[[3-(trifluoromethyl)phenyl]methylidene]-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridin-2-yl]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[5-methyl-3-phenyl-7-[[3-(trifluoromethyl)phenyl]methylidene]-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridin-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 157301618 |
| Molecular Formula | C26H31F3N4 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | N,N-dimethyl-3-[5-methyl-3-phenyl-7-[[3-(trifluoromethyl)phenyl]methylidene]-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridin-2-yl]propan-1-amine |
| SMILES | CN(C)CCCN1N=C2C(=Cc3cccc(C(F)(F)F)c3)CN(C)CC2C1c1ccccc1 |
| InChI | InChI=1S/C26H31F3N4/c1-31(2)13-8-14-33-25(20-10-5-4-6-11-20)23-18-32(3)17-21(24(23)30-33)15-19-9-7-12-22(16-19)26(27,28)29/h4-7,9-12,15-16,23,25H,8,13-14,17-18H2,1-3H3 |
| InChIKey | HZXPGBYSHMNPES-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |