C23H21F6N3 — CID 51697411
(3R,3aS,7E)-2,5-dimethyl-3-[4-(trifluoromethyl)phenyl]-7-[[4-(trifluoromethyl)phenyl]methylidene]-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine (PubChem CID 51697411) has the molecular formula C23H21F6N3 and a molecular weight of 453.43 g/mol. Its IUPAC name is (3R,3aS,7E)-2,5-dimethyl-3-[4-(trifluoromethyl)phenyl]-7-[[4-(trifluoromethyl)phenyl]methylidene]-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine.
| Compound Name | (3R,3aS,7E)-2,5-dimethyl-3-[4-(trifluoromethyl)phenyl]-7-[[4-(trifluoromethyl)phenyl]methylidene]-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 51697411 |
| Molecular Formula | C23H21F6N3 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | (3R,3aS,7E)-2,5-dimethyl-3-[4-(trifluoromethyl)phenyl]-7-[[4-(trifluoromethyl)phenyl]methylidene]-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine |
| SMILES | CN1C/C(=C\c2ccc(C(F)(F)F)cc2)C2=NN(C)[C@@H](c3ccc(C(F)(F)F)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C23H21F6N3/c1-31-12-16(11-14-3-7-17(8-4-14)22(24,25)26)20-19(13-31)21(32(2)30-20)15-5-9-18(10-6-15)23(27,28)29/h3-11,19,21H,12-13H2,1-2H3/b16-11+/t19-,21+/m1/s1 |
| InChIKey | KHYACKNGUMLYGX-RMKCNFRFSA-N |
| XLogP | 5.71 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |