C32H40F4N2O8 — CID 157302246
tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-hydroxyoxan-3-yl]carbamate;tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate (PubChem CID 157302246) has the molecular formula C32H40F4N2O8 and a molecular weight of 656.67 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-hydroxyoxan-3-yl]carbamate;tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-hydroxyoxan-3-yl]carbamate;tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate |
|---|---|
| PubChem CID | 157302246 |
| Molecular Formula | C32H40F4N2O8 |
| Molecular Weight | 656.67 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-hydroxyoxan-3-yl]carbamate;tert-butyl N-[(2R,3S)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(=O)CO[C@@H]1c1cc(F)ccc1F.CC(C)(C)OC(=O)N[C@H]1CC(O)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C16H21F2NO4.C16H19F2NO4/c2*1-16(2,3)23-15(21)19-13-7-10(20)8-22-14(13)11-6-9(17)4-5-12(11)18/h4-6,10,13-14,20H,7-8H2,1-3H3,(H,19,21);4-6,13-14H,7-8H2,1-3H3,(H,19,21)/t10?,13-,14+;13-,14+/m00/s1 |
| InChIKey | BCAQGBHHYQULEP-KABQMDGXSA-N |
| XLogP | 5.57 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.67 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |