C24H31F4N7O3 — CID 144979175
tert-butyl N-[(2R)-5-[3-(difluoromethyl)-2-[(Z)-N'-(methylamino)carbamimidoyl]-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-yl]carbamate (PubChem CID 144979175) has the molecular formula C24H31F4N7O3 and a molecular weight of 541.55 g/mol. Its IUPAC name is tert-butyl N-[(2R)-5-[3-(difluoromethyl)-2-[(Z)-N'-(methylamino)carbamimidoyl]-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-5-[3-(difluoromethyl)-2-[(Z)-N'-(methylamino)carbamimidoyl]-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 144979175 |
| Molecular Formula | C24H31F4N7O3 |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | tert-butyl N-[(2R)-5-[3-(difluoromethyl)-2-[(Z)-N'-(methylamino)carbamimidoyl]-4,6-dihydropyrrolo[3,4-d]imidazol-5-yl]-2-(2,5-difluorophenyl)oxan-3-yl]carbamate |
| SMILES | CN/N=C(\N)c1nc2c(n1C(F)F)CN(C1CO[C@H](c3cc(F)ccc3F)C(NC(=O)OC(C)(C)C)C1)C2 |
| InChI | InChI=1S/C24H31F4N7O3/c1-24(2,3)38-23(36)32-16-8-13(11-37-19(16)14-7-12(25)5-6-15(14)26)34-9-17-18(10-34)35(22(27)28)21(31-17)20(29)33-30-4/h5-7,13,16,19,22,30H,8-11H2,1-4H3,(H2,29,33)(H,32,36)/t13?,16?,19-/m1/s1 |
| InChIKey | AOMJKKLIBWBKFV-NSRCDFIJSA-N |
| XLogP | 3.14 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|