C21H26F2N4O3 — CID 118613995
tert-butyl N-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]imidazol-5-yl)oxan-3-yl]carbamate (PubChem CID 118613995) has the molecular formula C21H26F2N4O3 and a molecular weight of 420.46 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]imidazol-5-yl)oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]imidazol-5-yl)oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 118613995 |
| Molecular Formula | C21H26F2N4O3 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | tert-butyl N-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]imidazol-5-yl)oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](N2Cc3nc[nH]c3C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C21H26F2N4O3/c1-21(2,3)30-20(28)26-16-7-13(27-8-17-18(9-27)25-11-24-17)10-29-19(16)14-6-12(22)4-5-15(14)23/h4-6,11,13,16,19H,7-10H2,1-3H3,(H,24,25)(H,26,28)/t13-,16+,19-/m1/s1 |
| InChIKey | NDZFVJCZVDENRQ-ACWOFJMJSA-N |
| XLogP | 3.43 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |