C33H45BF2N2O6 — CID 175619297
tert-butyl N-[(3S)-2-(2,5-difluorophenyl)-5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidin-1-yl]oxan-3-yl]carbamate (PubChem CID 175619297) has the molecular formula C33H45BF2N2O6 and a molecular weight of 614.54 g/mol. Its IUPAC name is tert-butyl N-[(3S)-2-(2,5-difluorophenyl)-5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidin-1-yl]oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-2-(2,5-difluorophenyl)-5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidin-1-yl]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 175619297 |
| Molecular Formula | C33H45BF2N2O6 |
| Molecular Weight | 614.54 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | tert-butyl N-[(3S)-2-(2,5-difluorophenyl)-5-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]piperidin-1-yl]oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC(N2CCC(Oc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)CC2)COC1c1cc(F)ccc1F |
| InChI | InChI=1S/C33H45BF2N2O6/c1-31(2,3)42-30(39)37-28-19-23(20-40-29(28)26-18-22(35)10-13-27(26)36)38-16-14-25(15-17-38)41-24-11-8-21(9-12-24)34-43-32(4,5)33(6,7)44-34/h8-13,18,23,25,28-29H,14-17,19-20H2,1-7H3,(H,37,39)/t23?,28-,29?/m0/s1 |
| InChIKey | BWOMWUZMEYJTCA-NWPFNTSYSA-N |
| XLogP | 5.53 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|