C23H36BNO5 — CID 163675527
tert-butyl N-[3-[4-(6,6,7,7-tetramethyl-1,5,2-dioxaborepan-2-yl)phenoxy]cyclobutyl]carbamate (PubChem CID 163675527) has the molecular formula C23H36BNO5 and a molecular weight of 417.36 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(6,6,7,7-tetramethyl-1,5,2-dioxaborepan-2-yl)phenoxy]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(6,6,7,7-tetramethyl-1,5,2-dioxaborepan-2-yl)phenoxy]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 163675527 |
| Molecular Formula | C23H36BNO5 |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | tert-butyl N-[3-[4-(6,6,7,7-tetramethyl-1,5,2-dioxaborepan-2-yl)phenoxy]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC(Oc2ccc(B3CCOC(C)(C)C(C)(C)O3)cc2)C1 |
| InChI | InChI=1S/C23H36BNO5/c1-21(2,3)29-20(26)25-17-14-19(15-17)28-18-10-8-16(9-11-18)24-12-13-27-22(4,5)23(6,7)30-24/h8-11,17,19H,12-15H2,1-7H3,(H,25,26) |
| InChIKey | JGJADBHGDMALHM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|