C32H43BF2N2O6 — CID 164848916
tert-butyl N-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-[(3S)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidin-1-yl]oxan-3-yl]carbamate (PubChem CID 164848916) has the molecular formula C32H43BF2N2O6 and a molecular weight of 600.51 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-[(3S)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidin-1-yl]oxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-[(3S)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidin-1-yl]oxan-3-yl]carbamate |
|---|---|
| PubChem CID | 164848916 |
| Molecular Formula | C32H43BF2N2O6 |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | tert-butyl N-[(2R,3S,5R)-2-(2,5-difluorophenyl)-5-[(3S)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]pyrrolidin-1-yl]oxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](N2CC[C@H](Oc3ccc(B4OC(C)(C)C(C)(C)O4)cc3)C2)CO[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C32H43BF2N2O6/c1-30(2,3)41-29(38)36-27-17-22(19-39-28(27)25-16-21(34)10-13-26(25)35)37-15-14-24(18-37)40-23-11-8-20(9-12-23)33-42-31(4,5)32(6,7)43-33/h8-13,16,22,24,27-28H,14-15,17-19H2,1-7H3,(H,36,38)/t22-,24+,27+,28-/m1/s1 |
| InChIKey | QZINSSDZCYDHRN-SSVAKIOMSA-N |
| XLogP | 5.14 |
| TPSA | 78.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|