C21H34F2N2O3 — CID 158219860
tert-butyl N-[(2R,3S)-5-(butylamino)-2-(2,5-difluorophenyl)oxan-3-yl]carbamate;methane (PubChem CID 158219860) has the molecular formula C21H34F2N2O3 and a molecular weight of 400.51 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S)-5-(butylamino)-2-(2,5-difluorophenyl)oxan-3-yl]carbamate;methane.
| Compound Name | tert-butyl N-[(2R,3S)-5-(butylamino)-2-(2,5-difluorophenyl)oxan-3-yl]carbamate;methane |
|---|---|
| PubChem CID | 158219860 |
| Molecular Formula | C21H34F2N2O3 |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | tert-butyl N-[(2R,3S)-5-(butylamino)-2-(2,5-difluorophenyl)oxan-3-yl]carbamate;methane |
| SMILES | C.CCCCNC1CO[C@H](c2cc(F)ccc2F)[C@@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H30F2N2O3.CH4/c1-5-6-9-23-14-11-17(24-19(25)27-20(2,3)4)18(26-12-14)15-10-13(21)7-8-16(15)22;/h7-8,10,14,17-18,23H,5-6,9,11-12H2,1-4H3,(H,24,25);1H4/t14?,17-,18+;/m0./s1 |
| InChIKey | GDCQGYMVNXTMEU-HRZYPINMSA-N |
| XLogP | 4.71 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|