C40H27N5O3S2 — CID 157304649
N'-hydroxy-4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carbonitrile (PubChem CID 157304649) has the molecular formula C40H27N5O3S2 and a molecular weight of 689.82 g/mol. Its IUPAC name is N'-hydroxy-4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carbonitrile.
| Compound Name | N'-hydroxy-4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 157304649 |
| Molecular Formula | C40H27N5O3S2 |
| Molecular Weight | 689.82 g/mol |
| Exact Mass | 689.16 |
| IUPAC Name | N'-hydroxy-4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carboximidamide;4-(4-phenylphenoxy)thieno[2,3-c]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc2c(Oc3ccc(-c4ccccc4)cc3)cncc2s1.NC(=NO)c1cc2c(Oc3ccc(-c4ccccc4)cc3)cncc2s1 |
| InChI | InChI=1S/C20H15N3O2S.C20H12N2OS/c21-20(23-24)18-10-16-17(11-22-12-19(16)26-18)25-15-8-6-14(7-9-15)13-4-2-1-3-5-13;21-11-17-10-18-19(12-22-13-20(18)24-17)23-16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-12,24H,(H2,21,23);1-10,12-13H |
| InChIKey | BCHULPDVWWNIJE-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.82 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|