C40H26BF6IN2O4S2 — CID 159386687
4-(4-iodophenoxy)thieno[2,3-c]pyridine;[4-(trifluoromethyl)phenyl]boronic acid;4-[4-[4-(trifluoromethyl)phenyl]phenoxy]thieno[2,3-c]pyridine (PubChem CID 159386687) has the molecular formula C40H26BF6IN2O4S2 and a molecular weight of 914.50 g/mol. Its IUPAC name is 4-(4-iodophenoxy)thieno[2,3-c]pyridine;[4-(trifluoromethyl)phenyl]boronic acid;4-[4-[4-(trifluoromethyl)phenyl]phenoxy]thieno[2,3-c]pyridine.
| Compound Name | 4-(4-iodophenoxy)thieno[2,3-c]pyridine;[4-(trifluoromethyl)phenyl]boronic acid;4-[4-[4-(trifluoromethyl)phenyl]phenoxy]thieno[2,3-c]pyridine |
|---|---|
| PubChem CID | 159386687 |
| Molecular Formula | C40H26BF6IN2O4S2 |
| Molecular Weight | 914.50 g/mol |
| Exact Mass | 914.04 |
| IUPAC Name | 4-(4-iodophenoxy)thieno[2,3-c]pyridine;[4-(trifluoromethyl)phenyl]boronic acid;4-[4-[4-(trifluoromethyl)phenyl]phenoxy]thieno[2,3-c]pyridine |
| SMILES | FC(F)(F)c1ccc(-c2ccc(Oc3cncc4sccc34)cc2)cc1.Ic1ccc(Oc2cncc3sccc23)cc1.OB(O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H12F3NOS.C13H8INOS.C7H6BF3O2/c21-20(22,23)15-5-1-13(2-6-15)14-3-7-16(8-4-14)25-18-11-24-12-19-17(18)9-10-26-19;14-9-1-3-10(4-2-9)16-12-7-15-8-13-11(12)5-6-17-13;9-7(10,11)5-1-3-6(4-2-5)8(12)13/h1-12H;1-8H;1-4,12-13H |
| InChIKey | LLOWTKLEDUQTJL-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 84.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.50 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|