C18H17F3O8S — CID 157305076
[3-(hydroxymethyl)-4-oxo-5-propyl-8-(trifluoromethyl)-5H-pyrano[3,2-c]chromen-2-yl]oxymethanesulfonic acid (PubChem CID 157305076) has the molecular formula C18H17F3O8S and a molecular weight of 450.39 g/mol. Its IUPAC name is [3-(hydroxymethyl)-4-oxo-5-propyl-8-(trifluoromethyl)-5H-pyrano[3,2-c]chromen-2-yl]oxymethanesulfonic acid.
| Compound Name | [3-(hydroxymethyl)-4-oxo-5-propyl-8-(trifluoromethyl)-5H-pyrano[3,2-c]chromen-2-yl]oxymethanesulfonic acid |
|---|---|
| PubChem CID | 157305076 |
| Molecular Formula | C18H17F3O8S |
| Molecular Weight | 450.39 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | [3-(hydroxymethyl)-4-oxo-5-propyl-8-(trifluoromethyl)-5H-pyrano[3,2-c]chromen-2-yl]oxymethanesulfonic acid |
| SMILES | CCCC1Oc2cc(C(F)(F)F)ccc2-c2oc(OCS(=O)(=O)O)c(CO)c(=O)c21 |
| InChI | InChI=1S/C18H17F3O8S/c1-2-3-12-14-15(23)11(7-22)17(27-8-30(24,25)26)29-16(14)10-5-4-9(18(19,20)21)6-13(10)28-12/h4-6,12,22H,2-3,7-8H2,1H3,(H,24,25,26) |
| InChIKey | BCJDPBAVCZTMKU-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|