About 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine
2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine (PubChem CID 157305592) has the molecular formula C12H14BrClN8
and a molecular weight of 385.66 g/mol. Its IUPAC name is 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine.
Molecular Properties
| Compound Name | 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine |
| PubChem CID | 157305592 |
| Molecular Formula | C12H14BrClN8 |
| Molecular Weight | 385.66 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine |
| SMILES | N#CN/C(N)=N/CCBr.N#CN/C(N)=N/c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H7ClN4.C4H7BrN4/c9-6-2-1-3-7(4-6)13-8(11)12-5-10;5-1-2-8-4(7)9-3-6/h1-4H,(H3,11,12,13);1-2H2,(H3,7,8,9) |
| InChIKey | BCKSFNWCCNRTHT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.66 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine?
The IUPAC name of 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine (CID 157305592) is 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine.
What is the SMILES notation for 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine?
The canonical SMILES for 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine is N#CN/C(N)=N/CCBr.N#CN/C(N)=N/c1cccc(Cl)c1.
What is the InChIKey of 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine?
The InChIKey is BCKSFNWCCNRTHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN4.C4H7BrN4/c9-6-2-1-3-7(4-6)13-8(11)12-5-10;5-1-2-8-4(7)9-3-6/h1-4H,(H3,11,12,13);1-2H2,(H3,7,8,9).
What are the key properties of 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine?
2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine has a molecular weight of 385.66 g/mol, XLogP of 1.12, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromoethyl)-1-cyanoguanidine;2-(3-chlorophenyl)-1-cyanoguanidine is sourced from PubChem (CID 157305592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).