About 1-cyano-2-(1,3-thiazol-2-yl)guanidine
1-cyano-2-(1,3-thiazol-2-yl)guanidine (PubChem CID 86185534) has the molecular formula C5H5N5S
and a molecular weight of 167.20 g/mol. Its IUPAC name is 1-cyano-2-(1,3-thiazol-2-yl)guanidine.
Molecular Properties
| Compound Name | 1-cyano-2-(1,3-thiazol-2-yl)guanidine |
| PubChem CID | 86185534 |
| Molecular Formula | C5H5N5S |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 1-cyano-2-(1,3-thiazol-2-yl)guanidine |
| SMILES | N#CNC(N)=Nc1nccs1 |
| InChI | InChI=1S/C5H5N5S/c6-3-9-4(7)10-5-8-1-2-11-5/h1-2H,(H3,7,8,9,10) |
| InChIKey | RKFWWDIRKLHRLF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-2-(1,3-thiazol-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-2-(1,3-thiazol-2-yl)guanidine?
The IUPAC name of 1-cyano-2-(1,3-thiazol-2-yl)guanidine (CID 86185534) is 1-cyano-2-(1,3-thiazol-2-yl)guanidine.
What is the SMILES notation for 1-cyano-2-(1,3-thiazol-2-yl)guanidine?
The canonical SMILES for 1-cyano-2-(1,3-thiazol-2-yl)guanidine is N#CNC(N)=Nc1nccs1.
What is the InChIKey of 1-cyano-2-(1,3-thiazol-2-yl)guanidine?
The InChIKey is RKFWWDIRKLHRLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5S/c6-3-9-4(7)10-5-8-1-2-11-5/h1-2H,(H3,7,8,9,10).
What are the key properties of 1-cyano-2-(1,3-thiazol-2-yl)guanidine?
1-cyano-2-(1,3-thiazol-2-yl)guanidine has a molecular weight of 167.20 g/mol, XLogP of 0.16, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-2-(1,3-thiazol-2-yl)guanidine is sourced from PubChem (CID 86185534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).