C5H5N5S — CID 86185534
1-cyano-2-(1,3-thiazol-2-yl)guanidine (PubChem CID 86185534) has the molecular formula C5H5N5S and a molecular weight of 167.20 g/mol. Its IUPAC name is 1-cyano-2-(1,3-thiazol-2-yl)guanidine.
| Compound Name | 1-cyano-2-(1,3-thiazol-2-yl)guanidine |
|---|---|
| PubChem CID | 86185534 |
| Molecular Formula | C5H5N5S |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 1-cyano-2-(1,3-thiazol-2-yl)guanidine |
| SMILES | N#CNC(N)=Nc1nccs1 |
| InChI | InChI=1S/C5H5N5S/c6-3-9-4(7)10-5-8-1-2-11-5/h1-2H,(H3,7,8,9,10) |
| InChIKey | RKFWWDIRKLHRLF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|