C9H14N6S — CID 57193548
1-cyano-2-methyl-3-[2-[methyl(1,3-thiazol-2-yl)amino]ethyl]guanidine (PubChem CID 57193548) has the molecular formula C9H14N6S and a molecular weight of 238.32 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[2-[methyl(1,3-thiazol-2-yl)amino]ethyl]guanidine.
| Compound Name | 1-cyano-2-methyl-3-[2-[methyl(1,3-thiazol-2-yl)amino]ethyl]guanidine |
|---|---|
| PubChem CID | 57193548 |
| Molecular Formula | C9H14N6S |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-cyano-2-methyl-3-[2-[methyl(1,3-thiazol-2-yl)amino]ethyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCN(C)c1nccs1 |
| InChI | InChI=1S/C9H14N6S/c1-11-8(14-7-10)12-3-5-15(2)9-13-4-6-16-9/h4,6H,3,5H2,1-2H3,(H2,11,12,14) |
| InChIKey | CZMMCJQXZUJCBZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 76.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|