C6H8N2S — CID 28517512
N-cyclopropyl-1,3-thiazol-2-amine (PubChem CID 28517512) has the molecular formula C6H8N2S and a molecular weight of 140.21 g/mol. Its IUPAC name is N-cyclopropyl-1,3-thiazol-2-amine.
| Compound Name | N-cyclopropyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 28517512 |
| Molecular Formula | C6H8N2S |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.04 |
| IUPAC Name | N-cyclopropyl-1,3-thiazol-2-amine |
| SMILES | c1csc(NC2CC2)n1 |
| InChI | InChI=1S/C6H8N2S/c1-2-5(1)8-6-7-3-4-9-6/h3-5H,1-2H2,(H,7,8) |
| InChIKey | MOPNTLMUEMNVHP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |