methyl N-(1,3-thiazol-2-yl)ethanimidate

C6H8N2OS — CID 54190718

IUPACmethyl N-(1,3-thiazol-2-yl)ethanimidate
SMILESCOC(C)=Nc1nccs1
InChIInChI=1S/C6H8N2OS/c1-5(9-2)8-6-7-3-4-10-6/h3-4H,1-2H3
InChIKeyPIHSTVFBNWTLLP-UHFFFAOYSA-N
MW156.21 g/mol
LogP1.84
Rot. Bonds1

About methyl N-(1,3-thiazol-2-yl)ethanimidate

methyl N-(1,3-thiazol-2-yl)ethanimidate (PubChem CID 54190718) has the molecular formula C6H8N2OS and a molecular weight of 156.21 g/mol. Its IUPAC name is methyl N-(1,3-thiazol-2-yl)ethanimidate.

Molecular Properties

Compound Namemethyl N-(1,3-thiazol-2-yl)ethanimidate
PubChem CID54190718
Molecular FormulaC6H8N2OS
Molecular Weight156.21 g/mol
Exact Mass156.04
IUPAC Namemethyl N-(1,3-thiazol-2-yl)ethanimidate
SMILESCOC(C)=Nc1nccs1
InChIInChI=1S/C6H8N2OS/c1-5(9-2)8-6-7-3-4-10-6/h3-4H,1-2H3
InChIKeyPIHSTVFBNWTLLP-UHFFFAOYSA-N
XLogP1.84
TPSA34.48 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.21
LogP ≤ 51.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}

Analyze methyl N-(1,3-thiazol-2-yl)ethanimidate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl N-(1,3-thiazol-2-yl)ethanimidate?
The IUPAC name of methyl N-(1,3-thiazol-2-yl)ethanimidate (CID 54190718) is methyl N-(1,3-thiazol-2-yl)ethanimidate.
What is the SMILES notation for methyl N-(1,3-thiazol-2-yl)ethanimidate?
The canonical SMILES for methyl N-(1,3-thiazol-2-yl)ethanimidate is COC(C)=Nc1nccs1.
What is the InChIKey of methyl N-(1,3-thiazol-2-yl)ethanimidate?
The InChIKey is PIHSTVFBNWTLLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2OS/c1-5(9-2)8-6-7-3-4-10-6/h3-4H,1-2H3.
What are the key properties of methyl N-(1,3-thiazol-2-yl)ethanimidate?
methyl N-(1,3-thiazol-2-yl)ethanimidate has a molecular weight of 156.21 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(1,3-thiazol-2-yl)ethanimidate is sourced from PubChem (CID 54190718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).