C6H8N2OS — CID 76851886
methyl (1E)-N-(1,3-thiazol-2-yl)ethanimidate (PubChem CID 76851886) has the molecular formula C6H8N2OS and a molecular weight of 156.21 g/mol. Its IUPAC name is methyl (1E)-N-(1,3-thiazol-2-yl)ethanimidate.
| Compound Name | methyl (1E)-N-(1,3-thiazol-2-yl)ethanimidate |
|---|---|
| PubChem CID | 76851886 |
| Molecular Formula | C6H8N2OS |
| Molecular Weight | 156.21 g/mol |
| Exact Mass | 156.04 |
| IUPAC Name | methyl (1E)-N-(1,3-thiazol-2-yl)ethanimidate |
| SMILES | CO/C(C)=N/c1nccs1 |
| InChI | InChI=1S/C6H8N2OS/c1-5(9-2)8-6-7-3-4-10-6/h3-4H,1-2H3/b8-5+ |
| InChIKey | PIHSTVFBNWTLLP-VMPITWQZSA-N |
| XLogP | 1.84 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.21 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|