C18H20N2O6 — CID 157308457
2-(4,6-dioxopiperidin-3-yl)-5-(2-propoxyethoxy)isoindole-1,3-dione (PubChem CID 157308457) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is 2-(4,6-dioxopiperidin-3-yl)-5-(2-propoxyethoxy)isoindole-1,3-dione.
| Compound Name | 2-(4,6-dioxopiperidin-3-yl)-5-(2-propoxyethoxy)isoindole-1,3-dione |
|---|---|
| PubChem CID | 157308457 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-(4,6-dioxopiperidin-3-yl)-5-(2-propoxyethoxy)isoindole-1,3-dione |
| SMILES | CCCOCCOc1ccc2c(c1)C(=O)N(C1CNC(=O)CC1=O)C2=O |
| InChI | InChI=1S/C18H20N2O6/c1-2-5-25-6-7-26-11-3-4-12-13(8-11)18(24)20(17(12)23)14-10-19-16(22)9-15(14)21/h3-4,8,14H,2,5-7,9-10H2,1H3,(H,19,22) |
| InChIKey | QQAQXEDIKFSRKR-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|