C50H38F2O4 — CID 157319564
2-(2,5-dimethoxyphenyl)-1-fluoro-3,5-diphenylbenzene;2-(2-fluoro-4,6-diphenylphenyl)benzene-1,4-diol (PubChem CID 157319564) has the molecular formula C50H38F2O4 and a molecular weight of 740.85 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-1-fluoro-3,5-diphenylbenzene;2-(2-fluoro-4,6-diphenylphenyl)benzene-1,4-diol.
| Compound Name | 2-(2,5-dimethoxyphenyl)-1-fluoro-3,5-diphenylbenzene;2-(2-fluoro-4,6-diphenylphenyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 157319564 |
| Molecular Formula | C50H38F2O4 |
| Molecular Weight | 740.85 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-1-fluoro-3,5-diphenylbenzene;2-(2-fluoro-4,6-diphenylphenyl)benzene-1,4-diol |
| SMILES | COc1ccc(OC)c(-c2c(F)cc(-c3ccccc3)cc2-c2ccccc2)c1.Oc1ccc(O)c(-c2c(F)cc(-c3ccccc3)cc2-c2ccccc2)c1 |
| InChI | InChI=1S/C26H21FO2.C24H17FO2/c1-28-21-13-14-25(29-2)23(17-21)26-22(19-11-7-4-8-12-19)15-20(16-24(26)27)18-9-5-3-6-10-18;25-22-14-18(16-7-3-1-4-8-16)13-20(17-9-5-2-6-10-17)24(22)21-15-19(26)11-12-23(21)27/h3-17H,1-2H3;1-15,26-27H |
| InChIKey | BDZQUSQVDQRHTA-UHFFFAOYSA-N |
| XLogP | 13.08 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.85 |
| LogP ≤ 5 | 13.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|