C24H31NO5 — CID 157320847
N-[2-[2-(3-methylphenyl)-4-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]phenyl]ethyl]acetamide (PubChem CID 157320847) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is N-[2-[2-(3-methylphenyl)-4-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]phenyl]ethyl]acetamide.
| Compound Name | N-[2-[2-(3-methylphenyl)-4-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 157320847 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | N-[2-[2-(3-methylphenyl)-4-[[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]methyl]phenyl]ethyl]acetamide |
| SMILES | CC(=O)NCCc1ccc(C[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)cc1-c1cccc(C)c1 |
| InChI | InChI=1S/C24H31NO5/c1-14-5-4-6-19(11-14)20-12-17(7-8-18(20)9-10-25-16(3)26)13-21-23(28)24(29)22(27)15(2)30-21/h4-8,11-12,15,21-24,27-29H,9-10,13H2,1-3H3,(H,25,26)/t15-,21-,22-,23-,24+/m0/s1 |
| InChIKey | QBTQJJBYDYDJGG-ZYKPDOIRSA-N |
| XLogP | 1.75 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |