C41H45N3O8 — CID 157322223
(10,19-diethyl-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) [4-[2-(2-oxopropyl)heptanoylamino]phenyl]methyl carbonate (PubChem CID 157322223) has the molecular formula C41H45N3O8 and a molecular weight of 707.82 g/mol. Its IUPAC name is (10,19-diethyl-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) [4-[2-(2-oxopropyl)heptanoylamino]phenyl]methyl carbonate.
| Compound Name | (10,19-diethyl-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) [4-[2-(2-oxopropyl)heptanoylamino]phenyl]methyl carbonate |
|---|---|
| PubChem CID | 157322223 |
| Molecular Formula | C41H45N3O8 |
| Molecular Weight | 707.82 g/mol |
| Exact Mass | 707.32 |
| IUPAC Name | (10,19-diethyl-7-methyl-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-19-yl) [4-[2-(2-oxopropyl)heptanoylamino]phenyl]methyl carbonate |
| SMILES | CCCCCC(CC(C)=O)C(=O)Nc1ccc(COC(=O)OC2(CC)C(=O)OCc3c2cc2n(c3=O)Cc3c-2nc2ccc(C)cc2c3CC)cc1 |
| InChI | InChI=1S/C41H45N3O8/c1-6-9-10-11-27(19-25(5)45)37(46)42-28-15-13-26(14-16-28)22-51-40(49)52-41(8-3)33-20-35-36-31(21-44(35)38(47)32(33)23-50-39(41)48)29(7-2)30-18-24(4)12-17-34(30)43-36/h12-18,20,27H,6-11,19,21-23H2,1-5H3,(H,42,46) |
| InChIKey | NKWCFCZXLZIUMI-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 142.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.82 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|