C26H13ClF6N6O8 — CID 157325786
2-chloro-5-nitropyridine;4-hydroxy-2-(trifluoromethoxy)benzonitrile;4-[(5-nitro-2-pyridinyl)oxy]-2-(trifluoromethoxy)benzonitrile (PubChem CID 157325786) has the molecular formula C26H13ClF6N6O8 and a molecular weight of 686.87 g/mol. Its IUPAC name is 2-chloro-5-nitropyridine;4-hydroxy-2-(trifluoromethoxy)benzonitrile;4-[(5-nitro-2-pyridinyl)oxy]-2-(trifluoromethoxy)benzonitrile.
| Compound Name | 2-chloro-5-nitropyridine;4-hydroxy-2-(trifluoromethoxy)benzonitrile;4-[(5-nitro-2-pyridinyl)oxy]-2-(trifluoromethoxy)benzonitrile |
|---|---|
| PubChem CID | 157325786 |
| Molecular Formula | C26H13ClF6N6O8 |
| Molecular Weight | 686.87 g/mol |
| Exact Mass | 686.04 |
| IUPAC Name | 2-chloro-5-nitropyridine;4-hydroxy-2-(trifluoromethoxy)benzonitrile;4-[(5-nitro-2-pyridinyl)oxy]-2-(trifluoromethoxy)benzonitrile |
| SMILES | N#Cc1ccc(O)cc1OC(F)(F)F.N#Cc1ccc(Oc2ccc([N+](=O)[O-])cn2)cc1OC(F)(F)F.O=[N+]([O-])c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H6F3N3O4.C8H4F3NO2.C5H3ClN2O2/c14-13(15,16)23-11-5-10(3-1-8(11)6-17)22-12-4-2-9(7-18-12)19(20)21;9-8(10,11)14-7-3-6(13)2-1-5(7)4-12;6-5-2-1-4(3-7-5)8(9)10/h1-5,7H;1-3,13H;1-3H |
| InChIKey | BERXBOFEKTTYHP-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 207.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.87 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|