C17H11F3N4O4 — CID 162546565
4-[[5-[(4S)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-pyridinyl]oxy]-2-(trifluoromethoxy)benzonitrile (PubChem CID 162546565) has the molecular formula C17H11F3N4O4 and a molecular weight of 392.29 g/mol. Its IUPAC name is 4-[[5-[(4S)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-pyridinyl]oxy]-2-(trifluoromethoxy)benzonitrile.
| Compound Name | 4-[[5-[(4S)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-pyridinyl]oxy]-2-(trifluoromethoxy)benzonitrile |
|---|---|
| PubChem CID | 162546565 |
| Molecular Formula | C17H11F3N4O4 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 4-[[5-[(4S)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-pyridinyl]oxy]-2-(trifluoromethoxy)benzonitrile |
| SMILES | C[C@@H]1NC(=O)N(c2ccc(Oc3ccc(C#N)c(OC(F)(F)F)c3)nc2)C1=O |
| InChI | InChI=1S/C17H11F3N4O4/c1-9-15(25)24(16(26)23-9)11-3-5-14(22-8-11)27-12-4-2-10(7-21)13(6-12)28-17(18,19)20/h2-6,8-9H,1H3,(H,23,26)/t9-/m0/s1 |
| InChIKey | BQTGBUNKBWTAHP-VIFPVBQESA-N |
| XLogP | 3.09 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|