C27H33N3O2 — CID 157330597
(2R,6S,14S,16R)-14-(dimethylamino)-6-methyl-N-pyridin-3-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-5-carboxamide (PubChem CID 157330597) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is (2R,6S,14S,16R)-14-(dimethylamino)-6-methyl-N-pyridin-3-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-5-carboxamide.
| Compound Name | (2R,6S,14S,16R)-14-(dimethylamino)-6-methyl-N-pyridin-3-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-5-carboxamide |
|---|---|
| PubChem CID | 157330597 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | (2R,6S,14S,16R)-14-(dimethylamino)-6-methyl-N-pyridin-3-yl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-triene-5-carboxamide |
| SMILES | CN(C)[C@H]1CCC2=CC3=CC[C@]4(C)C(C(=O)Nc5cccnc5)=CC[C@H]4C34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C27H33N3O2/c1-25-11-10-19-15-18-6-7-21(30(2)3)16-26(18)12-13-27(19,32-26)23(25)9-8-22(25)24(31)29-20-5-4-14-28-17-20/h4-5,8,10,14-15,17,21,23H,6-7,9,11-13,16H2,1-3H3,(H,29,31)/t21-,23+,25+,26+,27?/m0/s1 |
| InChIKey | IXMBYEUNLLOILA-HDGNTJCPSA-N |
| XLogP | 4.64 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |