C30H35NO — CID 162104044
(2R,6S,14R,16R)-5-(1H-inden-5-yl)-N,N,6-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-14-amine (PubChem CID 162104044) has the molecular formula C30H35NO and a molecular weight of 425.62 g/mol. Its IUPAC name is (2R,6S,14R,16R)-5-(1H-inden-5-yl)-N,N,6-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-14-amine.
| Compound Name | (2R,6S,14R,16R)-5-(1H-inden-5-yl)-N,N,6-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-14-amine |
|---|---|
| PubChem CID | 162104044 |
| Molecular Formula | C30H35NO |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | (2R,6S,14R,16R)-5-(1H-inden-5-yl)-N,N,6-trimethyl-19-oxapentacyclo[14.2.1.01,9.02,6.011,16]nonadeca-4,8,10-trien-14-amine |
| SMILES | CN(C)[C@@H]1CCC2=CC3=CC[C@]4(C)C(c5ccc6c(c5)C=CC6)=CC[C@H]4C34CC[C@]2(C1)O4 |
| InChI | InChI=1S/C30H35NO/c1-28-14-13-24-18-23-9-10-25(31(2)3)19-29(23)15-16-30(24,32-29)27(28)12-11-26(28)22-8-7-20-5-4-6-21(20)17-22/h4,6-8,11,13,17-18,25,27H,5,9-10,12,14-16,19H2,1-3H3/t25-,27-,28-,29-,30?/m1/s1 |
| InChIKey | POXKDGHXHDGGJV-ZJZZWORSSA-N |
| XLogP | 6.34 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |